C24H30FN3O — CID 86678034
3-[4-[4-[4-(2-fluoroethoxy)phenyl]piperazin-1-yl]butyl]-1H-indole (PubChem CID 86678034) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 3-[4-[4-[4-(2-fluoroethoxy)phenyl]piperazin-1-yl]butyl]-1H-indole.
| Compound Name | 3-[4-[4-[4-(2-fluoroethoxy)phenyl]piperazin-1-yl]butyl]-1H-indole |
|---|---|
| PubChem CID | 86678034 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-[4-[4-[4-(2-fluoroethoxy)phenyl]piperazin-1-yl]butyl]-1H-indole |
| SMILES | FCCOc1ccc(N2CCN(CCCCc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H30FN3O/c25-12-18-29-22-10-8-21(9-11-22)28-16-14-27(15-17-28)13-4-3-5-20-19-26-24-7-2-1-6-23(20)24/h1-2,6-11,19,26H,3-5,12-18H2 |
| InChIKey | GWLBJIUIDLRTGN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|