C27H30N4 — CID 135178455
3-[4-[4-(5-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-1H-indole (PubChem CID 135178455) has the molecular formula C27H30N4 and a molecular weight of 410.57 g/mol. Its IUPAC name is 3-[4-[4-(5-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-1H-indole.
| Compound Name | 3-[4-[4-(5-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-1H-indole |
|---|---|
| PubChem CID | 135178455 |
| Molecular Formula | C27H30N4 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3-[4-[4-(5-phenyl-2-pyridinyl)piperazin-1-yl]butyl]-1H-indole |
| SMILES | c1ccc(-c2ccc(N3CCN(CCCCc4c[nH]c5ccccc45)CC3)nc2)cc1 |
| InChI | InChI=1S/C27H30N4/c1-2-8-22(9-3-1)23-13-14-27(29-20-23)31-18-16-30(17-19-31)15-7-6-10-24-21-28-26-12-5-4-11-25(24)26/h1-5,8-9,11-14,20-21,28H,6-7,10,15-19H2 |
| InChIKey | FFHROXMGUSULGM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|