C25H33N3O2S — CID 166658549
1-[3-[4-[3-(1H-indol-3-yl)propylamino]sulfanylphenoxy]propyl]piperidin-4-ol (PubChem CID 166658549) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-[3-[4-[3-(1H-indol-3-yl)propylamino]sulfanylphenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[4-[3-(1H-indol-3-yl)propylamino]sulfanylphenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 166658549 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-[3-[4-[3-(1H-indol-3-yl)propylamino]sulfanylphenoxy]propyl]piperidin-4-ol |
| SMILES | OC1CCN(CCCOc2ccc(SNCCCc3c[nH]c4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O2S/c29-21-12-16-28(17-13-21)15-4-18-30-22-8-10-23(11-9-22)31-27-14-3-5-20-19-26-25-7-2-1-6-24(20)25/h1-2,6-11,19,21,26-27,29H,3-5,12-18H2 |
| InChIKey | FNUSIFAZDCTBMH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|