C26H35ClN4S — CID 166658624
3-(5-chloro-1H-indol-3-yl)-N-[4-[4-(4-methylpiperazin-1-yl)butyl]phenyl]sulfanylpropan-1-amine (PubChem CID 166658624) has the molecular formula C26H35ClN4S and a molecular weight of 471.11 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-N-[4-[4-(4-methylpiperazin-1-yl)butyl]phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-[4-(4-methylpiperazin-1-yl)butyl]phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658624 |
| Molecular Formula | C26H35ClN4S |
| Molecular Weight | 471.11 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-[4-(4-methylpiperazin-1-yl)butyl]phenyl]sulfanylpropan-1-amine |
| SMILES | CN1CCN(CCCCc2ccc(SNCCCc3c[nH]c4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C26H35ClN4S/c1-30-15-17-31(18-16-30)14-3-2-5-21-7-10-24(11-8-21)32-29-13-4-6-22-20-28-26-12-9-23(27)19-25(22)26/h7-12,19-20,28-29H,2-6,13-18H2,1H3 |
| InChIKey | ZRFIBJUCHXIASA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.11 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|