C27H31ClN6S — CID 166658567
N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 166658567) has the molecular formula C27H31ClN6S and a molecular weight of 507.11 g/mol. Its IUPAC name is N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 166658567 |
| Molecular Formula | C27H31ClN6S |
| Molecular Weight | 507.11 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CN1CCN(c2ccnc(Nc3ccc(SNCCCc4c[nH]c5ccc(Cl)cc45)cc3)c2)CC1 |
| InChI | InChI=1S/C27H31ClN6S/c1-33-13-15-34(16-14-33)23-10-12-29-27(18-23)32-22-5-7-24(8-6-22)35-31-11-2-3-20-19-30-26-9-4-21(28)17-25(20)26/h4-10,12,17-19,30-31H,2-3,11,13-16H2,1H3,(H,29,32) |
| InChIKey | BXRUPOZXFYSXEV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.11 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|