C26H35N3OS — CID 166658603
3-(1H-indol-3-yl)-N-[4-[3-(1-methylpiperidin-4-yl)propoxy]phenyl]sulfanylpropan-1-amine (PubChem CID 166658603) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-[4-[3-(1-methylpiperidin-4-yl)propoxy]phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(1H-indol-3-yl)-N-[4-[3-(1-methylpiperidin-4-yl)propoxy]phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658603 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-[4-[3-(1-methylpiperidin-4-yl)propoxy]phenyl]sulfanylpropan-1-amine |
| SMILES | CN1CCC(CCCOc2ccc(SNCCCc3c[nH]c4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C26H35N3OS/c1-29-17-14-21(15-18-29)6-5-19-30-23-10-12-24(13-11-23)31-28-16-4-7-22-20-27-26-9-3-2-8-25(22)26/h2-3,8-13,20-21,27-28H,4-7,14-19H2,1H3 |
| InChIKey | FZHJGOZGNHFBSL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|