C25H32FN3OS — CID 166658598
3-(5-fluoro-1H-indol-3-yl)-N-[4-(3-piperidin-4-ylpropoxy)phenyl]sulfanylpropan-1-amine (PubChem CID 166658598) has the molecular formula C25H32FN3OS and a molecular weight of 441.62 g/mol. Its IUPAC name is 3-(5-fluoro-1H-indol-3-yl)-N-[4-(3-piperidin-4-ylpropoxy)phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(5-fluoro-1H-indol-3-yl)-N-[4-(3-piperidin-4-ylpropoxy)phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658598 |
| Molecular Formula | C25H32FN3OS |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-(5-fluoro-1H-indol-3-yl)-N-[4-(3-piperidin-4-ylpropoxy)phenyl]sulfanylpropan-1-amine |
| SMILES | Fc1ccc2[nH]cc(CCCNSc3ccc(OCCCC4CCNCC4)cc3)c2c1 |
| InChI | InChI=1S/C25H32FN3OS/c26-21-5-10-25-24(17-21)20(18-28-25)4-1-13-29-31-23-8-6-22(7-9-23)30-16-2-3-19-11-14-27-15-12-19/h5-10,17-19,27-29H,1-4,11-16H2 |
| InChIKey | OCPXQFRXJABALB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|