C25H31Cl2N3OS — CID 166658512
3-(5-chloro-1H-indol-3-yl)-N-[4-[3-(4-chloropiperidin-1-yl)propoxy]phenyl]sulfanylpropan-1-amine (PubChem CID 166658512) has the molecular formula C25H31Cl2N3OS and a molecular weight of 492.52 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-N-[4-[3-(4-chloropiperidin-1-yl)propoxy]phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-[3-(4-chloropiperidin-1-yl)propoxy]phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658512 |
| Molecular Formula | C25H31Cl2N3OS |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-[3-(4-chloropiperidin-1-yl)propoxy]phenyl]sulfanylpropan-1-amine |
| SMILES | Clc1ccc2[nH]cc(CCCNSc3ccc(OCCCN4CCC(Cl)CC4)cc3)c2c1 |
| InChI | InChI=1S/C25H31Cl2N3OS/c26-20-10-14-30(15-11-20)13-2-16-31-22-5-7-23(8-6-22)32-29-12-1-3-19-18-28-25-9-4-21(27)17-24(19)25/h4-9,17-18,20,28-29H,1-3,10-16H2 |
| InChIKey | AHMRIHSDRQXIEI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|