C26H34ClN3S — CID 166658492
3-(5-chloro-1H-indol-3-yl)-N-[4-(4-piperidin-1-ylbutyl)phenyl]sulfanylpropan-1-amine (PubChem CID 166658492) has the molecular formula C26H34ClN3S and a molecular weight of 456.10 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-N-[4-(4-piperidin-1-ylbutyl)phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-(4-piperidin-1-ylbutyl)phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658492 |
| Molecular Formula | C26H34ClN3S |
| Molecular Weight | 456.10 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-N-[4-(4-piperidin-1-ylbutyl)phenyl]sulfanylpropan-1-amine |
| SMILES | Clc1ccc2[nH]cc(CCCNSc3ccc(CCCCN4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C26H34ClN3S/c27-23-11-14-26-25(19-23)22(20-28-26)8-6-15-29-31-24-12-9-21(10-13-24)7-2-5-18-30-16-3-1-4-17-30/h9-14,19-20,28-29H,1-8,15-18H2 |
| InChIKey | CUGCSVOFUWKTMP-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.10 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|