C27H30Cl2N6S — CID 166658520
6-chloro-N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 166658520) has the molecular formula C27H30Cl2N6S and a molecular weight of 541.55 g/mol. Its IUPAC name is 6-chloro-N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 166658520 |
| Molecular Formula | C27H30Cl2N6S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 6-chloro-N-[4-[3-(5-chloro-1H-indol-3-yl)propylamino]sulfanylphenyl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CN1CCN(c2cc(Cl)nc(Nc3ccc(SNCCCc4c[nH]c5ccc(Cl)cc45)cc3)c2)CC1 |
| InChI | InChI=1S/C27H30Cl2N6S/c1-34-11-13-35(14-12-34)22-16-26(29)33-27(17-22)32-21-5-7-23(8-6-21)36-31-10-2-3-19-18-30-25-9-4-20(28)15-24(19)25/h4-9,15-18,30-31H,2-3,10-14H2,1H3,(H,32,33) |
| InChIKey | GLEIQZASWMCTCN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|