C26H35FN4OS — CID 166658478
N-[4-[3-(4-ethylpiperazin-1-yl)propoxy]phenyl]sulfanyl-3-(5-fluoro-1H-indol-3-yl)propan-1-amine (PubChem CID 166658478) has the molecular formula C26H35FN4OS and a molecular weight of 470.66 g/mol. Its IUPAC name is N-[4-[3-(4-ethylpiperazin-1-yl)propoxy]phenyl]sulfanyl-3-(5-fluoro-1H-indol-3-yl)propan-1-amine.
| Compound Name | N-[4-[3-(4-ethylpiperazin-1-yl)propoxy]phenyl]sulfanyl-3-(5-fluoro-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 166658478 |
| Molecular Formula | C26H35FN4OS |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N-[4-[3-(4-ethylpiperazin-1-yl)propoxy]phenyl]sulfanyl-3-(5-fluoro-1H-indol-3-yl)propan-1-amine |
| SMILES | CCN1CCN(CCCOc2ccc(SNCCCc3c[nH]c4ccc(F)cc34)cc2)CC1 |
| InChI | InChI=1S/C26H35FN4OS/c1-2-30-14-16-31(17-15-30)13-4-18-32-23-7-9-24(10-8-23)33-29-12-3-5-21-20-28-26-11-6-22(27)19-25(21)26/h6-11,19-20,28-29H,2-5,12-18H2,1H3 |
| InChIKey | YQDASWOKKVCPFK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|