C23H30ClN5OS — CID 166658641
3-(5-chloro-2H-indazol-3-yl)-N-[4-(3-piperazin-1-ylpropoxy)phenyl]sulfanylpropan-1-amine (PubChem CID 166658641) has the molecular formula C23H30ClN5OS and a molecular weight of 460.05 g/mol. Its IUPAC name is 3-(5-chloro-2H-indazol-3-yl)-N-[4-(3-piperazin-1-ylpropoxy)phenyl]sulfanylpropan-1-amine.
| Compound Name | 3-(5-chloro-2H-indazol-3-yl)-N-[4-(3-piperazin-1-ylpropoxy)phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 166658641 |
| Molecular Formula | C23H30ClN5OS |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-(5-chloro-2H-indazol-3-yl)-N-[4-(3-piperazin-1-ylpropoxy)phenyl]sulfanylpropan-1-amine |
| SMILES | Clc1ccc2n[nH]c(CCCNSc3ccc(OCCCN4CCNCC4)cc3)c2c1 |
| InChI | InChI=1S/C23H30ClN5OS/c24-18-4-9-23-21(17-18)22(27-28-23)3-1-10-26-31-20-7-5-19(6-8-20)30-16-2-13-29-14-11-25-12-15-29/h4-9,17,25-26H,1-3,10-16H2,(H,27,28) |
| InChIKey | WOADFTJPHYANQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|