C30H36N6O2 — CID 69419133
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 69419133) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69419133 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc2cc(N3CCN(CCCCc4c[nH]c5ccc(C#N)cc45)CC3)ccc2o1 |
| InChI | InChI=1S/C30H36N6O2/c1-34(2)12-10-32-30(37)29-19-24-18-25(7-9-28(24)38-29)36-15-13-35(14-16-36)11-4-3-5-23-21-33-27-8-6-22(20-31)17-26(23)27/h6-9,17-19,21,33H,3-5,10-16H2,1-2H3,(H,32,37) |
| InChIKey | XYTBJSAKHQBZBO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|