C33H39N5O2 — CID 174400257
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-cyclohexyl-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 174400257) has the molecular formula C33H39N5O2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-cyclohexyl-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-cyclohexyl-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 174400257 |
| Molecular Formula | C33H39N5O2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-cyclohexyl-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCCCC2)oc2ccc(N3CCN(CCCCc4c[nH]c5ccc(C#N)cc45)CC3)cc12 |
| InChI | InChI=1S/C33H39N5O2/c1-23-28-20-27(11-13-31(28)40-32(23)33(39)36-26-8-3-2-4-9-26)38-17-15-37(16-18-38)14-6-5-7-25-22-35-30-12-10-24(21-34)19-29(25)30/h10-13,19-20,22,26,35H,2-9,14-18H2,1H3,(H,36,39) |
| InChIKey | GDCZHIZQYLGDAA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|