C31H33N7O2 — CID 69419179
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 69419179) has the molecular formula C31H33N7O2 and a molecular weight of 535.65 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69419179 |
| Molecular Formula | C31H33N7O2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5oc(C(=O)NCCc6cnc[nH]6)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C31H33N7O2/c32-18-22-4-6-28-27(15-22)23(19-35-28)3-1-2-10-37-11-13-38(14-12-37)26-5-7-29-24(16-26)17-30(40-29)31(39)34-9-8-25-20-33-21-36-25/h4-7,15-17,19-21,35H,1-3,8-14H2,(H,33,36)(H,34,39) |
| InChIKey | HDRQQFOZMFHRME-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|