C31H30N6O2 — CID 69419842
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-pyridin-2-yl-1-benzofuran-2-carboxamide (PubChem CID 69419842) has the molecular formula C31H30N6O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-pyridin-2-yl-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-pyridin-2-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69419842 |
| Molecular Formula | C31H30N6O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-N-pyridin-2-yl-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5oc(C(=O)Nc6ccccn6)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C31H30N6O2/c32-20-22-7-9-27-26(17-22)23(21-34-27)5-2-4-12-36-13-15-37(16-14-36)25-8-10-28-24(18-25)19-29(39-28)31(38)35-30-6-1-3-11-33-30/h1,3,6-11,17-19,21,34H,2,4-5,12-16H2,(H,33,35,38) |
| InChIKey | DIHGAZFANNYMLD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|