C40H35N5O4 — CID 71092267
N-benzoyl-5-[4-[4-(1-benzoyl-5-cyanoindol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 71092267) has the molecular formula C40H35N5O4 and a molecular weight of 649.75 g/mol. Its IUPAC name is N-benzoyl-5-[4-[4-(1-benzoyl-5-cyanoindol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-benzoyl-5-[4-[4-(1-benzoyl-5-cyanoindol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 71092267 |
| Molecular Formula | C40H35N5O4 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | N-benzoyl-5-[4-[4-(1-benzoyl-5-cyanoindol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2c(c1)c(CCCCN1CCN(c3ccc4oc(C(=O)NC(=O)c5ccccc5)cc4c3)CC1)cn2C(=O)c1ccccc1 |
| InChI | InChI=1S/C40H35N5O4/c41-26-28-14-16-35-34(23-28)31(27-45(35)40(48)30-11-5-2-6-12-30)13-7-8-18-43-19-21-44(22-20-43)33-15-17-36-32(24-33)25-37(49-36)39(47)42-38(46)29-9-3-1-4-10-29/h1-6,9-12,14-17,23-25,27H,7-8,13,18-22H2,(H,42,46,47) |
| InChIKey | DUVPXNQBJICXLC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|