C32H36N6O5 — CID 71092275
[5-[4-[4-[1-(2-amino-3-methylbutanoyl)-5-cyanoindol-3-yl]butyl]piperazin-1-yl]-1-benzofuran-2-carbonyl]carbamic acid (PubChem CID 71092275) has the molecular formula C32H36N6O5 and a molecular weight of 584.68 g/mol. Its IUPAC name is [5-[4-[4-[1-(2-amino-3-methylbutanoyl)-5-cyanoindol-3-yl]butyl]piperazin-1-yl]-1-benzofuran-2-carbonyl]carbamic acid.
| Compound Name | [5-[4-[4-[1-(2-amino-3-methylbutanoyl)-5-cyanoindol-3-yl]butyl]piperazin-1-yl]-1-benzofuran-2-carbonyl]carbamic acid |
|---|---|
| PubChem CID | 71092275 |
| Molecular Formula | C32H36N6O5 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | [5-[4-[4-[1-(2-amino-3-methylbutanoyl)-5-cyanoindol-3-yl]butyl]piperazin-1-yl]-1-benzofuran-2-carbonyl]carbamic acid |
| SMILES | CC(C)C(N)C(=O)n1cc(CCCCN2CCN(c3ccc4oc(C(=O)NC(=O)O)cc4c3)CC2)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C32H36N6O5/c1-20(2)29(34)31(40)38-19-22(25-15-21(18-33)6-8-26(25)38)5-3-4-10-36-11-13-37(14-12-36)24-7-9-27-23(16-24)17-28(43-27)30(39)35-32(41)42/h6-9,15-17,19-20,29H,3-5,10-14,34H2,1-2H3,(H,35,39)(H,41,42) |
| InChIKey | SZGVQCLVTGWTLM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 157.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|