C37H39N5O4 — CID 71092350
5-[4-[4-[5-cyano-1-(cyclopropanecarbonyl)indol-3-yl]butyl]piperazin-1-yl]-N-(cyclopropanecarbonyl)-N-cyclopropyl-1-benzofuran-2-carboxamide (PubChem CID 71092350) has the molecular formula C37H39N5O4 and a molecular weight of 617.75 g/mol. Its IUPAC name is 5-[4-[4-[5-cyano-1-(cyclopropanecarbonyl)indol-3-yl]butyl]piperazin-1-yl]-N-(cyclopropanecarbonyl)-N-cyclopropyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-[5-cyano-1-(cyclopropanecarbonyl)indol-3-yl]butyl]piperazin-1-yl]-N-(cyclopropanecarbonyl)-N-cyclopropyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 71092350 |
| Molecular Formula | C37H39N5O4 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 5-[4-[4-[5-cyano-1-(cyclopropanecarbonyl)indol-3-yl]butyl]piperazin-1-yl]-N-(cyclopropanecarbonyl)-N-cyclopropyl-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2c(c1)c(CCCCN1CCN(c3ccc4oc(C(=O)N(C(=O)C5CC5)C5CC5)cc4c3)CC1)cn2C(=O)C1CC1 |
| InChI | InChI=1S/C37H39N5O4/c38-22-24-4-12-32-31(19-24)27(23-41(32)35(43)25-5-6-25)3-1-2-14-39-15-17-40(18-16-39)30-11-13-33-28(20-30)21-34(46-33)37(45)42(29-9-10-29)36(44)26-7-8-26/h4,11-13,19-21,23,25-26,29H,1-3,5-10,14-18H2 |
| InChIKey | WNSPJQCFPISYHA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|