C44H41N7O6S2 — CID 71092220
5-[4-[4-[5-cyano-1-(phenylsulfamoyl)indol-3-yl]butyl]piperazin-1-yl]-3-phenyl-N-(phenylsulfamoyl)-1-benzofuran-2-carboxamide (PubChem CID 71092220) has the molecular formula C44H41N7O6S2 and a molecular weight of 827.99 g/mol. Its IUPAC name is 5-[4-[4-[5-cyano-1-(phenylsulfamoyl)indol-3-yl]butyl]piperazin-1-yl]-3-phenyl-N-(phenylsulfamoyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-[5-cyano-1-(phenylsulfamoyl)indol-3-yl]butyl]piperazin-1-yl]-3-phenyl-N-(phenylsulfamoyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 71092220 |
| Molecular Formula | C44H41N7O6S2 |
| Molecular Weight | 827.99 g/mol |
| Exact Mass | 827.26 |
| IUPAC Name | 5-[4-[4-[5-cyano-1-(phenylsulfamoyl)indol-3-yl]butyl]piperazin-1-yl]-3-phenyl-N-(phenylsulfamoyl)-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2c(c1)c(CCCCN1CCN(c3ccc4oc(C(=O)NS(=O)(=O)Nc5ccccc5)c(-c5ccccc5)c4c3)CC1)cn2S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C44H41N7O6S2/c45-30-32-19-21-40-38(28-32)34(31-51(40)59(55,56)47-36-17-8-3-9-18-36)14-10-11-23-49-24-26-50(27-25-49)37-20-22-41-39(29-37)42(33-12-4-1-5-13-33)43(57-41)44(52)48-58(53,54)46-35-15-6-2-7-16-35/h1-9,12-13,15-22,28-29,31,46-47H,10-11,14,23-27H2,(H,48,52) |
| InChIKey | UZXFZKXRWIYORP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.99 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|