C24H26FN3O6 — CID 22725288
3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-fluoro-1H-indole;oxalic acid (PubChem CID 22725288) has the molecular formula C24H26FN3O6 and a molecular weight of 471.49 g/mol. Its IUPAC name is 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-fluoro-1H-indole;oxalic acid.
| Compound Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-fluoro-1H-indole;oxalic acid |
|---|---|
| PubChem CID | 22725288 |
| Molecular Formula | C24H26FN3O6 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-fluoro-1H-indole;oxalic acid |
| SMILES | Fc1ccc2[nH]cc(CCN3CCN(c4cccc5c4OCCO5)CC3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H24FN3O2.C2H2O4/c23-17-4-5-19-18(14-17)16(15-24-19)6-7-25-8-10-26(11-9-25)20-2-1-3-21-22(20)28-13-12-27-21;3-1(4)2(5)6/h1-5,14-15,24H,6-13H2;(H,3,4)(H,5,6) |
| InChIKey | OMDLBYMFWZMMPQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|