C21H24N2O2 — CID 155258071
3-[[3-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1H-indole (PubChem CID 155258071) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[[3-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1H-indole.
| Compound Name | 3-[[3-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 155258071 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[[3-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-1H-indole |
| SMILES | COc1ccc(C2CCN(Cc3c[nH]c4ccccc34)C2)cc1OC |
| InChI | InChI=1S/C21H24N2O2/c1-24-20-8-7-15(11-21(20)25-2)16-9-10-23(13-16)14-17-12-22-19-6-4-3-5-18(17)19/h3-8,11-12,16,22H,9-10,13-14H2,1-2H3 |
| InChIKey | YHNDDKZXFUNKMZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |