C20H22N2S — CID 155258161
5-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]-2-methylbenzenethiol (PubChem CID 155258161) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is 5-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]-2-methylbenzenethiol.
| Compound Name | 5-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]-2-methylbenzenethiol |
|---|---|
| PubChem CID | 155258161 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 5-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]-2-methylbenzenethiol |
| SMILES | Cc1ccc(C2CCN(Cc3c[nH]c4ccccc34)C2)cc1S |
| InChI | InChI=1S/C20H22N2S/c1-14-6-7-15(10-20(14)23)16-8-9-22(12-16)13-17-11-21-19-5-3-2-4-18(17)19/h2-7,10-11,16,21,23H,8-9,12-13H2,1H3 |
| InChIKey | KSNFVCYFUFPHAC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|