C23H27N3OS — CID 155258130
N-[3-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]phenyl]cyclobutanesulfinamide (PubChem CID 155258130) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-[3-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]phenyl]cyclobutanesulfinamide.
| Compound Name | N-[3-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]phenyl]cyclobutanesulfinamide |
|---|---|
| PubChem CID | 155258130 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[3-[1-(1H-indol-3-ylmethyl)pyrrolidin-3-yl]phenyl]cyclobutanesulfinamide |
| SMILES | O=S(Nc1cccc(C2CCN(Cc3c[nH]c4ccccc34)C2)c1)C1CCC1 |
| InChI | InChI=1S/C23H27N3OS/c27-28(21-7-4-8-21)25-20-6-3-5-17(13-20)18-11-12-26(15-18)16-19-14-24-23-10-2-1-9-22(19)23/h1-3,5-6,9-10,13-14,18,21,24-25H,4,7-8,11-12,15-16H2 |
| InChIKey | KUCUUUAVIRBBIU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |