C25H27N3O3 — CID 21190411
7-hydroxy-6-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]chromen-2-one (PubChem CID 21190411) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 7-hydroxy-6-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]chromen-2-one.
| Compound Name | 7-hydroxy-6-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]chromen-2-one |
|---|---|
| PubChem CID | 21190411 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 7-hydroxy-6-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]chromen-2-one |
| SMILES | O=c1ccc2cc(N3CCN(CCCCc4c[nH]c5ccccc45)CC3)c(O)cc2o1 |
| InChI | InChI=1S/C25H27N3O3/c29-23-16-24-18(8-9-25(30)31-24)15-22(23)28-13-11-27(12-14-28)10-4-3-5-19-17-26-21-7-2-1-6-20(19)21/h1-2,6-9,15-17,26,29H,3-5,10-14H2 |
| InChIKey | QAYPRMWWZPFMDO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|