C37H45BrN4O — CID 166633146
3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-bromo-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one (PubChem CID 166633146) has the molecular formula C37H45BrN4O and a molecular weight of 641.70 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-bromo-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-bromo-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 166633146 |
| Molecular Formula | C37H45BrN4O |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-1-[4-[4-[4-(5-bromo-1H-indol-3-yl)butyl]piperazin-1-yl]phenyl]propan-1-one |
| SMILES | O=C(CCC1CCN(Cc2ccccc2)CC1)c1ccc(N2CCN(CCCCc3c[nH]c4ccc(Br)cc34)CC2)cc1 |
| InChI | InChI=1S/C37H45BrN4O/c38-33-12-15-36-35(26-33)32(27-39-36)8-4-5-19-40-22-24-42(25-23-40)34-13-10-31(11-14-34)37(43)16-9-29-17-20-41(21-18-29)28-30-6-2-1-3-7-30/h1-3,6-7,10-15,26-27,29,39H,4-5,8-9,16-25,28H2 |
| InChIKey | YBNPWOYOYCFQFX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|