C38H45N5O — CID 166625247
3-[4-[4-[3-[3-(1-benzylpiperidin-4-yl)propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 166625247) has the molecular formula C38H45N5O and a molecular weight of 587.81 g/mol. Its IUPAC name is 3-[4-[4-[3-[3-(1-benzylpiperidin-4-yl)propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-[3-[3-(1-benzylpiperidin-4-yl)propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 166625247 |
| Molecular Formula | C38H45N5O |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 3-[4-[4-[3-[3-(1-benzylpiperidin-4-yl)propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4cccc(C(=O)CCC5CCN(Cc6ccccc6)CC5)c4)CC3)c2c1 |
| InChI | InChI=1S/C38H45N5O/c39-27-32-12-14-37-36(25-32)34(28-40-37)9-4-5-18-41-21-23-43(24-22-41)35-11-6-10-33(26-35)38(44)15-13-30-16-19-42(20-17-30)29-31-7-2-1-3-8-31/h1-3,6-8,10-12,14,25-26,28,30,40H,4-5,9,13,15-24,29H2 |
| InChIKey | XZWIGRIXJBNFGX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|