C36H43N5OS — CID 166631374
3-[4-[4-[4-[3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 166631374) has the molecular formula C36H43N5OS and a molecular weight of 593.84 g/mol. Its IUPAC name is 3-[4-[4-[4-[3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-[4-[3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 166631374 |
| Molecular Formula | C36H43N5OS |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | 3-[4-[4-[4-[3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]propanoyl]phenyl]piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(C(=O)CCC5CCN(Cc6ccsc6)CC5)cc4)CC3)c2c1 |
| InChI | InChI=1S/C36H43N5OS/c37-24-29-4-10-35-34(23-29)32(25-38-35)3-1-2-15-39-18-20-41(21-19-39)33-8-6-31(7-9-33)36(42)11-5-28-12-16-40(17-13-28)26-30-14-22-43-27-30/h4,6-10,14,22-23,25,27-28,38H,1-3,5,11-13,15-21,26H2 |
| InChIKey | FJSLNYNYGJRYEB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|