C25H31N3O2 — CID 139660266
3-[1-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]propan-2-yl]-5-methoxy-1H-indole (PubChem CID 139660266) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[1-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]propan-2-yl]-5-methoxy-1H-indole.
| Compound Name | 3-[1-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]propan-2-yl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 139660266 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[1-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]propan-2-yl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(C(C)CN3CCN(c4ccc5c(c4)CCCO5)CC3)c2c1 |
| InChI | InChI=1S/C25H31N3O2/c1-18(23-16-26-24-7-6-21(29-2)15-22(23)24)17-27-9-11-28(12-10-27)20-5-8-25-19(14-20)4-3-13-30-25/h5-8,14-16,18,26H,3-4,9-13,17H2,1-2H3 |
| InChIKey | HFPIOCGNNJHYDQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|