C21H24FN3O2 — CID 2037410
(1R)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1-(5-methoxy-1H-indol-3-yl)ethanol (PubChem CID 2037410) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (1R)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1-(5-methoxy-1H-indol-3-yl)ethanol.
| Compound Name | (1R)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1-(5-methoxy-1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 2037410 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (1R)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1-(5-methoxy-1H-indol-3-yl)ethanol |
| SMILES | COc1ccc2[nH]cc([C@@H](O)CN3CCN(c4ccccc4F)CC3)c2c1 |
| InChI | InChI=1S/C21H24FN3O2/c1-27-15-6-7-19-16(12-15)17(13-23-19)21(26)14-24-8-10-25(11-9-24)20-5-3-2-4-18(20)22/h2-7,12-13,21,23,26H,8-11,14H2,1H3/t21-/m0/s1 |
| InChIKey | RFOBCKLQZBNPMH-NRFANRHFSA-N |
| XLogP | 3.17 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |