C20H21F2N3O — CID 92736475
(1R)-1-(5-fluoro-1H-indol-3-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanol (PubChem CID 92736475) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is (1R)-1-(5-fluoro-1H-indol-3-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanol.
| Compound Name | (1R)-1-(5-fluoro-1H-indol-3-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 92736475 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (1R)-1-(5-fluoro-1H-indol-3-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanol |
| SMILES | O[C@@H](CN1CCN(c2ccc(F)cc2)CC1)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H21F2N3O/c21-14-1-4-16(5-2-14)25-9-7-24(8-10-25)13-20(26)18-12-23-19-6-3-15(22)11-17(18)19/h1-6,11-12,20,23,26H,7-10,13H2/t20-/m0/s1 |
| InChIKey | AHKWZAGHIGYNGD-FQEVSTJZSA-N |
| XLogP | 3.30 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |