About (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol
(1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol (PubChem CID 92556048) has the molecular formula C22H26FN3O
and a molecular weight of 367.47 g/mol. Its IUPAC name is (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol |
| PubChem CID | 92556048 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol |
| SMILES | Cc1ccc(N2CCN(C[C@H](O)c3c[nH]c4ccc(F)cc34)CC2)c(C)c1 |
| InChI | InChI=1S/C22H26FN3O/c1-15-3-6-21(16(2)11-15)26-9-7-25(8-10-26)14-22(27)19-13-24-20-5-4-17(23)12-18(19)20/h3-6,11-13,22,24,27H,7-10,14H2,1-2H3/t22-/m0/s1 |
| InChIKey | DCSZNNAYBJOULZ-QFIPXVFZSA-N |
| XLogP | 3.78 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol?
The IUPAC name of (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol (CID 92556048) is (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol.
What is the SMILES notation for (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol?
The canonical SMILES for (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol is Cc1ccc(N2CCN(C[C@H](O)c3c[nH]c4ccc(F)cc34)CC2)c(C)c1.
What is the InChIKey of (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol?
The InChIKey is DCSZNNAYBJOULZ-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H26FN3O/c1-15-3-6-21(16(2)11-15)26-9-7-25(8-10-26)14-22(27)19-13-24-20-5-4-17(23)12-18(19)20/h3-6,11-13,22,24,27H,7-10,14H2,1-2H3/t22-/m0/s1.
What are the key properties of (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol?
(1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol has a molecular weight of 367.47 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-1-(5-fluoro-1H-indol-3-yl)ethanol is sourced from PubChem (CID 92556048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).