C31H36N4O4 — CID 46102324
2-(2,5-dimethoxyphenyl)-N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]acetamide (PubChem CID 46102324) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]acetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]acetamide |
|---|---|
| PubChem CID | 46102324 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CCc3c[nH]c4ccc(NC(=O)Cc5cc(OC)ccc5OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C31H36N4O4/c1-37-26-7-5-25(6-8-26)35-16-14-34(15-17-35)13-12-22-21-32-29-10-4-24(20-28(22)29)33-31(36)19-23-18-27(38-2)9-11-30(23)39-3/h4-11,18,20-21,32H,12-17,19H2,1-3H3,(H,33,36) |
| InChIKey | IPADLCXTTBOBDE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|