C29H29F3N4O3 — CID 46102326
N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]-2-(trifluoromethoxy)benzamide (PubChem CID 46102326) has the molecular formula C29H29F3N4O3 and a molecular weight of 538.57 g/mol. Its IUPAC name is N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 46102326 |
| Molecular Formula | C29H29F3N4O3 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-[3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1H-indol-5-yl]-2-(trifluoromethoxy)benzamide |
| SMILES | COc1ccc(N2CCN(CCc3c[nH]c4ccc(NC(=O)c5ccccc5OC(F)(F)F)cc34)CC2)cc1 |
| InChI | InChI=1S/C29H29F3N4O3/c1-38-23-9-7-22(8-10-23)36-16-14-35(15-17-36)13-12-20-19-33-26-11-6-21(18-25(20)26)34-28(37)24-4-2-3-5-27(24)39-29(30,31)32/h2-11,18-19,33H,12-17H2,1H3,(H,34,37) |
| InChIKey | GHDCWVDACRLZLN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|