C25H22F10N4O — CID 46102314
2,2,3,3,4,4,4-heptafluoro-N-[3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-indol-5-yl]butanamide (PubChem CID 46102314) has the molecular formula C25H22F10N4O and a molecular weight of 584.46 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-indol-5-yl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-indol-5-yl]butanamide |
|---|---|
| PubChem CID | 46102314 |
| Molecular Formula | C25H22F10N4O |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-indol-5-yl]butanamide |
| SMILES | O=C(Nc1ccc2[nH]cc(CCN3CCN(c4cccc(C(F)(F)F)c4)CC3)c2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H22F10N4O/c26-22(27,24(31,32)25(33,34)35)21(40)37-17-4-5-20-19(13-17)15(14-36-20)6-7-38-8-10-39(11-9-38)18-3-1-2-16(12-18)23(28,29)30/h1-5,12-14,36H,6-11H2,(H,37,40) |
| InChIKey | XDJVIAAAVDVNRN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|