C19H26F2N2O2 — CID 176862217
3-[2-[4-(difluoromethoxymethyl)azepan-1-yl]ethyl]-5-methoxy-1H-indole (PubChem CID 176862217) has the molecular formula C19H26F2N2O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[2-[4-(difluoromethoxymethyl)azepan-1-yl]ethyl]-5-methoxy-1H-indole.
| Compound Name | 3-[2-[4-(difluoromethoxymethyl)azepan-1-yl]ethyl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 176862217 |
| Molecular Formula | C19H26F2N2O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 3-[2-[4-(difluoromethoxymethyl)azepan-1-yl]ethyl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(CCN3CCCC(COC(F)F)CC3)c2c1 |
| InChI | InChI=1S/C19H26F2N2O2/c1-24-16-4-5-18-17(11-16)15(12-22-18)7-10-23-8-2-3-14(6-9-23)13-25-19(20)21/h4-5,11-12,14,19,22H,2-3,6-10,13H2,1H3 |
| InChIKey | IZBIWDXDTFTHOL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |