C19H20N4 — CID 10470310
3-[4-(pyridin-3-ylmethylamino)butyl]-1H-indole-5-carbonitrile (PubChem CID 10470310) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[4-(pyridin-3-ylmethylamino)butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-(pyridin-3-ylmethylamino)butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 10470310 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-[4-(pyridin-3-ylmethylamino)butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCNCc3cccnc3)c2c1 |
| InChI | InChI=1S/C19H20N4/c20-11-15-6-7-19-18(10-15)17(14-23-19)5-1-2-8-21-12-16-4-3-9-22-13-16/h3-4,6-7,9-10,13-14,21,23H,1-2,5,8,12H2 |
| InChIKey | FZNKMCPDVPCZLO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|