C21H21N5O2 — CID 10248888
3-[4-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]butyl]-1H-indole-5-carbonitrile (PubChem CID 10248888) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[4-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 10248888 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-[4-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCNCCOc3ccc4nonc4c3)c2c1 |
| InChI | InChI=1S/C21H21N5O2/c22-13-15-4-6-19-18(11-15)16(14-24-19)3-1-2-8-23-9-10-27-17-5-7-20-21(12-17)26-28-25-20/h4-7,11-12,14,23-24H,1-3,8-10H2 |
| InChIKey | LTTMVNDWTNNTBQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|