C25H24N4O4 — CID 69144819
5-[3-[4-(5-cyano-1H-indol-3-yl)butylamino]propanoylamino]-1-benzofuran-2-carboxylic acid (PubChem CID 69144819) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-[3-[4-(5-cyano-1H-indol-3-yl)butylamino]propanoylamino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[3-[4-(5-cyano-1H-indol-3-yl)butylamino]propanoylamino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 69144819 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 5-[3-[4-(5-cyano-1H-indol-3-yl)butylamino]propanoylamino]-1-benzofuran-2-carboxylic acid |
| SMILES | N#Cc1ccc2[nH]cc(CCCCNCCC(=O)Nc3ccc4oc(C(=O)O)cc4c3)c2c1 |
| InChI | InChI=1S/C25H24N4O4/c26-14-16-4-6-21-20(11-16)17(15-28-21)3-1-2-9-27-10-8-24(30)29-19-5-7-22-18(12-19)13-23(33-22)25(31)32/h4-7,11-13,15,27-28H,1-3,8-10H2,(H,29,30)(H,31,32) |
| InChIKey | WJTAGIRNLIWAGF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 131.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|