C26H28ClN5O2 — CID 67301217
5-[1-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-2-yl]-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 67301217) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 5-[1-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-2-yl]-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | 5-[1-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-2-yl]-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67301217 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5-[1-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-2-yl]-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc2[nH]cc(CCCCN3CCNCC3c3ccc4oc(C(N)=O)cc4c3)c2c1 |
| InChI | InChI=1S/C26H27N5O2.ClH/c27-14-17-4-6-22-21(11-17)19(15-30-22)3-1-2-9-31-10-8-29-16-23(31)18-5-7-24-20(12-18)13-25(33-24)26(28)32;/h4-7,11-13,15,23,29-30H,1-3,8-10,16H2,(H2,28,32);1H |
| InChIKey | DDIXGYIYPXMXDQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|