C27H27N3O3 — CID 11224490
3-[4-[4-(2-oxochromen-7-yl)oxypiperidin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 11224490) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[4-[4-(2-oxochromen-7-yl)oxypiperidin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-(2-oxochromen-7-yl)oxypiperidin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 11224490 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3-[4-[4-(2-oxochromen-7-yl)oxypiperidin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCC(Oc4ccc5ccc(=O)oc5c4)CC3)c2c1 |
| InChI | InChI=1S/C27H27N3O3/c28-17-19-4-8-25-24(15-19)21(18-29-25)3-1-2-12-30-13-10-22(11-14-30)32-23-7-5-20-6-9-27(31)33-26(20)16-23/h4-9,15-16,18,22,29H,1-3,10-14H2 |
| InChIKey | SMAIHQCHQZFHKF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|