C25H25N5O3 — CID 69143814
5-[[2-[5-(5-cyano-1H-indol-3-yl)pentylamino]acetyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 69143814) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 5-[[2-[5-(5-cyano-1H-indol-3-yl)pentylamino]acetyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-[[2-[5-(5-cyano-1H-indol-3-yl)pentylamino]acetyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 69143814 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 5-[[2-[5-(5-cyano-1H-indol-3-yl)pentylamino]acetyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccc2[nH]cc(CCCCCNCC(=O)Nc3ccc4oc(C(N)=O)cc4c3)c2c1 |
| InChI | InChI=1S/C25H25N5O3/c26-13-16-5-7-21-20(10-16)17(14-29-21)4-2-1-3-9-28-15-24(31)30-19-6-8-22-18(11-19)12-23(33-22)25(27)32/h5-8,10-12,14,28-29H,1-4,9,15H2,(H2,27,32)(H,30,31) |
| InChIKey | NXKXBEQDMLLDAV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|