C19H17N5O2 — CID 68844257
3-[2-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]ethyl]-1H-indole-5-carbonitrile (PubChem CID 68844257) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3-[2-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]ethyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]ethyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 68844257 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[2-[2-(2,1,3-benzoxadiazol-5-yloxy)ethylamino]ethyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCNCCOc3ccc4nonc4c3)c2c1 |
| InChI | InChI=1S/C19H17N5O2/c20-11-13-1-3-17-16(9-13)14(12-22-17)5-6-21-7-8-25-15-2-4-18-19(10-15)24-26-23-18/h1-4,9-10,12,21-22H,5-8H2 |
| InChIKey | ZAANQHTXMBYEMO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|