C23H22N4 — CID 10155105
3-[2-[[2-(1H-indol-3-yl)ethylamino]methyl]cyclopropyl]-1H-indole-5-carbonitrile (PubChem CID 10155105) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 3-[2-[[2-(1H-indol-3-yl)ethylamino]methyl]cyclopropyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-[[2-(1H-indol-3-yl)ethylamino]methyl]cyclopropyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 10155105 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[2-[[2-(1H-indol-3-yl)ethylamino]methyl]cyclopropyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C3CC3CNCCc3c[nH]c4ccccc34)c2c1 |
| InChI | InChI=1S/C23H22N4/c24-11-15-5-6-23-20(9-15)21(14-27-23)19-10-17(19)12-25-8-7-16-13-26-22-4-2-1-3-18(16)22/h1-6,9,13-14,17,19,25-27H,7-8,10,12H2 |
| InChIKey | SFJIITPEHFLLPT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|