C17H23FN2 — CID 22638713
N-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-3-methylbutan-1-amine (PubChem CID 22638713) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is N-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 22638713 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-3-methylbutan-1-amine |
| SMILES | CC(C)CCNCC1CC1c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C17H23FN2/c1-11(2)5-6-19-9-12-7-14(12)16-10-20-17-4-3-13(18)8-15(16)17/h3-4,8,10-12,14,19-20H,5-7,9H2,1-2H3 |
| InChIKey | YLOANQLJGUNYTK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|