C20H29FN4O — CID 91432534
3-[2-(ethylamino)ethyl]-1-[[(1R,2R)-2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-1-propylurea (PubChem CID 91432534) has the molecular formula C20H29FN4O and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[2-(ethylamino)ethyl]-1-[[(1R,2R)-2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-1-propylurea.
| Compound Name | 3-[2-(ethylamino)ethyl]-1-[[(1R,2R)-2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-1-propylurea |
|---|---|
| PubChem CID | 91432534 |
| Molecular Formula | C20H29FN4O |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-[2-(ethylamino)ethyl]-1-[[(1R,2R)-2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]-1-propylurea |
| SMILES | CCCN(C[C@@H]1C[C@H]1c1c[nH]c2ccc(F)cc12)C(=O)NCCNCC |
| InChI | InChI=1S/C20H29FN4O/c1-3-9-25(20(26)23-8-7-22-4-2)13-14-10-16(14)18-12-24-19-6-5-15(21)11-17(18)19/h5-6,11-12,14,16,22,24H,3-4,7-10,13H2,1-2H3,(H,23,26)/t14-,16+/m0/s1 |
| InChIKey | GLTPOIGRJCBJCM-GOEBONIOSA-N |
| XLogP | 3.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|