C20H26N4O2 — CID 142174176
propyl N-[2-[[2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate (PubChem CID 142174176) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is propyl N-[2-[[2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate.
| Compound Name | propyl N-[2-[[2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 142174176 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | propyl N-[2-[[2-(5-cyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate |
| SMILES | CCCOC(=O)NCCN(C)CC1CC1c1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C20H26N4O2/c1-3-8-26-20(25)22-6-7-24(2)13-15-10-16(15)18-12-23-19-5-4-14(11-21)9-17(18)19/h4-5,9,12,15-16,23H,3,6-8,10,13H2,1-2H3,(H,22,25) |
| InChIKey | KSUCLVCWWSNLHT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |