C21H21N3 — CID 22638776
3-[2-[[benzyl(methyl)amino]methyl]cyclopropyl]-1H-indole-6-carbonitrile (PubChem CID 22638776) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[2-[[benzyl(methyl)amino]methyl]cyclopropyl]-1H-indole-6-carbonitrile.
| Compound Name | 3-[2-[[benzyl(methyl)amino]methyl]cyclopropyl]-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 22638776 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-[2-[[benzyl(methyl)amino]methyl]cyclopropyl]-1H-indole-6-carbonitrile |
| SMILES | CN(Cc1ccccc1)CC1CC1c1c[nH]c2cc(C#N)ccc12 |
| InChI | InChI=1S/C21H21N3/c1-24(13-15-5-3-2-4-6-15)14-17-10-19(17)20-12-23-21-9-16(11-22)7-8-18(20)21/h2-9,12,17,19,23H,10,13-14H2,1H3 |
| InChIKey | MHVSABVUOMJPBJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |