C13H9N3O2 — CID 118512091
3-(2,5-dioxopyrrolidin-3-yl)-1H-indole-6-carbonitrile (PubChem CID 118512091) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-3-yl)-1H-indole-6-carbonitrile.
| Compound Name | 3-(2,5-dioxopyrrolidin-3-yl)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 118512091 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-3-yl)-1H-indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(C3CC(=O)NC3=O)c[nH]c2c1 |
| InChI | InChI=1S/C13H9N3O2/c14-5-7-1-2-8-10(6-15-11(8)3-7)9-4-12(17)16-13(9)18/h1-3,6,9,15H,4H2,(H,16,17,18) |
| InChIKey | YNIWEPZVRHRUTM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|