C13H12N2O3 — CID 86240712
3-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 86240712) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86240712 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(C3CC(=O)NC3=O)c[nH]c2c1 |
| InChI | InChI=1S/C13H12N2O3/c1-18-7-2-3-8-10(6-14-11(8)4-7)9-5-12(16)15-13(9)17/h2-4,6,9,14H,5H2,1H3,(H,15,16,17) |
| InChIKey | NXKCBNXCDAFMKQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|